Divaplon: Difference between revisions

Jump to navigation Jump to search
Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
BogBot (talk | contribs)
Bots
53,132 edits
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot
m link benzodiazepine
 
(15 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
⚫
| verifiedrevid = 451223995
| Verifiedfields = changed
⚫
| verifiedrevid = 399960666
| IUPAC_name = (6-ethyl-7-methoxy-5-methylimidazo[1,2-a]pyrimidin-2-yl)-phenylmethanone
| IUPAC_name = (6-ethyl-7-methoxy-5-methylimidazo[1,2-a]pyrimidin-2-yl)-phenylmethanone
| image = Divaplon.png
| image = Divaplon Structure.svg
| width = 180
| width = 180


Line 18: Line 18:


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 90808-12-1
| CAS_number = 90808-12-1
| ATC_prefix = none
| ATC_prefix = none
Line 24: Line 25:
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4AOV43246G
| UNII = 4AOV43246G
| ChemSpiderID = 59234
| ChEMBL = 281164


<!--Chemical data-->
<!--Chemical data-->
| C=17 | H=17 | N=3 | O=2
| C=17 | H=17 | N=3 | O=2
| molecular_weight = 295.336
| smiles = CCC1=C(N2C=C(N=C2N=C1OC)C(=O)C3=CC=CC=C3)C
| smiles = CCC1=C(N2C=C(N=C2N=C1OC)C(=O)C3=CC=CC=C3)C
| StdInChI = 1S/C17H17N3O2/c1-4-13-11(2)20-10-14(18-17(20)19-16(13)22-3)15(21)12-8-6-5-7-9-12/h5-10H,4H2,1-3H3
| StdInChIKey = NRJVHCSYLGLURI-UHFFFAOYSA-N
}}
}}


'''Divaplon''' ('''RU-32698''') is a [[nonbenzodiazepine]], [[anxiolytic]] and [[anticonvulsant]] drug from the [[pyrazolopyrimidine]] family of drugs. It acts as a [[partial agonist]] at the "benzodiazepine site" of the [[GABAA receptor|GABA<sub>A</sub>]] [[Receptor (biochemistry)|receptor]] in the brain.<ref>{{cite journal | last1 = Feely | first1 = M | last2 = Boyland | first2 = P | last3 = Picardo | first3 = A | last4 = Cox | first4 = A | last5 = Gent | first5 = JP | title = Lack of anticonvulsant tolerance with RU 32698 and Ro 17-1812 | journal = European journal of pharmacology | volume = 164 | issue = 2 | pages = 377–80 | year = 1989 | pmid = 2759183 | doi=10.1016/0014-2999(89)90482-2}}</ref><ref>{{cite journal | last1 = Sanger | first1 = DJ | last2 = Joly | first2 = D | last3 = Perrault | first3 = G | title = Benzodiazepine (omega) receptor partial agonists and the acquisition of conditioned fear in mice | journal = Psychopharmacology | volume = 121 | issue = 1 | pages = 104–8 | year = 1995 | pmid = 8539334 }}</ref><ref>{{cite journal | last1 = Pellón | first1 = R | last2 = Ruíz | first2 = A | last3 = Lamas | first3 = E | last4 = Rodríguez | first4 = C | title = Pharmacological analysis of the effects of benzodiazepines on punished schedule-induced polydipsia in rats | journal = Behavioural pharmacology | volume = 18 | issue = 1 | pages = 81–7 | year = 2007 | pmid = 17218801 | doi = 10.1097/FBP.0b013e3280143212 }}</ref>
'''Divaplon''' ('''RU-32698''') is a [[nonbenzodiazepine]], [[anxiolytic]] and [[anticonvulsant]] drug from the [[imidazopyrimidine]] family of drugs. It acts as a [[partial agonist]] at the "[[benzodiazepine]] site" of the [[GABAA receptor|GABA<sub>A</sub>]] [[Receptor (biochemistry)|receptor]] in the brain.<ref>{{cite journal | vauthors = Feely M, Boyland P, Picardo A, Cox A, Gent JP | title = Lack of anticonvulsant tolerance with RU 32698 and Ro 17-1812 | journal = European Journal of Pharmacology | volume = 164 | issue = 2 | pages = 377–80 | date = May 1989 | pmid = 2759183 | doi = 10.1016/0014-2999(89)90482-2 }}</ref><ref>{{cite journal | vauthors = Sanger DJ, Joly D, Perrault G | s2cid = 32627339 | title = Benzodiazepine (omega) receptor partial agonists and the acquisition of conditioned fear in mice | journal = Psychopharmacology | volume = 121 | issue = 1 | pages = 104–8 | date = September 1995 | pmid = 8539334 | doi = 10.1007/BF02245596 }}</ref><ref>{{cite journal | vauthors = Pellón R, Ruíz A, Lamas E, Rodríguez C | title = Pharmacological analysis of the effects of benzodiazepines on punished schedule-induced polydipsia in rats | journal = Behavioural Pharmacology | volume = 18 | issue = 1 | pages = 81–7 | date = February 2007 | pmid = 17218801 | doi = 10.1097/FBP.0b013e3280143212 | s2cid = 40188048 }}</ref>


==References==
== References ==
{{reflist}}
<references/>


{{Anxiolytics}}
{{Anxiolytics}}
{{GABAAR PAMs}}


[[Category:Anxiolytics]]
[[Category:Anxiolytics]]
[[Category:Ketones]]
[[Category:Aromatic ketones]]
[[Category:Ethers]]
[[Category:Ethers]]
[[Category:Imidazopyrimidines]]
[[Category:Imidazopyrimidines]]
[[Category:GABAA receptor positive allosteric modulators]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"