CataCXium F sulf: Difference between revisions

Jump to navigation Jump to search
Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation
 
(26 intermediate revisions by 14 users not shown)
Line 1: Line 1:
{{orphan|date=August 2009}}

{{chembox
{{chembox
| Watchedfields = changed
| verifiedrevid = 428759792
| verifiedrevid = 447493788
| ImageFile = CatFsulf.png
| ImageFile = CatFsulf.png
| ImageSize = 200px
| ImageSize = 190
| ImageFile1 = CataCXium F sulf ions ball.png
⚫
| IUPACName = Dicyclohexyl-{9-[3-(4-sulfonylphenyl)propyl]-2-sulfonylfluoren-9-yl}phosphonium hydrogensulfate
| ImageSize1 = 220
| ImageAlt1 = Ball-and-stick model of the ions in CataCXium F
⚫
| IUPACName = (±)-Dicyclohexyl-<nowiki/>{9-[3-(4-sulfonylphenyl)propyl]-2-sulfonylfluoren-9-yl}phosphonium hydrogensulfate
| OtherNames = CataCXium F sulf
| OtherNames = CataCXium F sulf
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo =
| CASNo = 1039775-34-2
| PubChem =
| PubChem = 24878816
| SMILES =
| ChemSpiderID = 28475201
| SMILES = c1ccc2c(c1)-c3ccc(cc3C2(CCCc4ccc(cc4)S(=O)(=O)O)[PH+](C5CCCCC5)C6CCCCC6)S(=O)(=O)O.OS(=O)(=O)[O-]
| StdInChI = 1S/C34H41O6PS2.H2O4S/c35-42(36,37)28-19-17-25(18-20-28)10-9-23-34(41(26-11-3-1-4-12-26)27-13-5-2-6-14-27)32-16-8-7-15-30(32)31-22-21-29(24-33(31)34)43(38,39)40;1-5(2,3)4/h7-8,15-22,24,26-27H,1-6,9-14,23H2,(H,35,36,37)(H,38,39,40);(H2,1,2,3,4)
| StdInChIKey = HNJNDGZFLWQSEG-UHFFFAOYSA-N

}}
}}
| Section2 = {{Chembox Properties
|Section2={{Chembox Properties
| Formula = C<sub>34</sub>H<sub>43</sub>O<sub>10</sub>PS<sub>3
| Formula = C<sub>34</sub>H<sub>43</sub>O<sub>10</sub>PS<sub>3</sub>
| MolarMass = 738.87 g/mol
| MolarMass = 738.87 g/mol
| Appearance = pale yellow solid
| Appearance = pale yellow solid
| Density =
| Density =
| MeltingPt =
| MeltingPt =
| BoilingPt =
| BoilingPt =
| SolubleOther = soluble in water
| SolubleOther = soluble in water
}}
}}
| Section3 = {{Chembox Hazards
|Section3={{Chembox Hazards
| MainHazards =
| MainHazards =
| FlashPt =
| FlashPt =
| Autoignition =
| AutoignitionPt =
| GHSSignalWord = Warning
| GHSPictograms = {{GHS07}}
| HPhrases = {{H-phrases|315|319|335}}
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}
}}
}}
}}
}}


'''CataCXium F sulf''' is a water-soluble [[organophosphorus compound]] derived from [[fluorene]]. The palladium complexes of the respective phosphine show an excellent activity in various palladium catalyzed [[cross coupling reaction]]s, including [[Suzuki reaction]]s, [[Sonogashira coupling]]s and [[Buchwald-Hartwig reaction]]s.
'''CataCXium F sulf''' is a water-soluble [[organophosphorus compound]] derived from [[fluorene]]. The [[palladium]] complexes of the respective phosphine{{clarify|date=June 2014}} show an excellent activity in various [[palladium-catalyzed coupling reactions]], including [[Suzuki reaction]]s, [[Sonogashira coupling]]s and [[Buchwald–Hartwig reaction]]s.


==References==
==References==
⚫
* C.A. Fleckenstein; H. Plenio, Highly efficient Suzuki-Miyaura coupling of heterocyclic substrates through rational reaction design. ''Chemistry-A European Journal'' '''2008''', ''14(14)'', 4267–4279.

* C.A. Fleckenstein; H. Plenio, Highly efficient Suzuki-Miyaura coupling of heterocyclic substrates through rational reaction design. ''Chemistry-A European Journal'' '''2008''', ''14(14)'', 4267-4279.
* C.A. Fleckenstein; H. Plenio, Aqueous/organic cross coupling: Sustainable protocol for Sonogashira reactions of heterocycles. ''Green Chemistry'' '''2008''', ''10'', 563–570. {{doi|10.1039/B800154E}}
⚫
* C.A. Fleckenstein; H. Plenio, Efficient Suzuki-Miyaura Coupling of (Hetero)aryl Chlorides with Thiophene- and Furanboronic Acids in Aqueous ''n''-Butanol. ''Journal of Organic Chemistry'' '''2008''', ''73'', 3236–3244.

* C.A. Fleckenstein; H. Plenio, Aqueous/organic cross coupling: Sustainable protocol for Sonogashira reactions of heterocycles. ''Green Chemistry'' '''2008''', ''10'', 563-570.
* C.A Fleckenstein; R. Kadyrov; H. Plenio, Efficient Large-Scale Synthesis of 9-Alkylfluorenyl Phosphines for Pd-Catalyzed Cross-Coupling Reactions. ''Organic Process Research & Development'' '''2008''', ''12'', 475–479.
* C.A. Fleckenstein; H. Plenio, Aqueous cross-coupling. Highly efficient Suzuki–Miyaura coupling of ''N''-heteroaryl halides and ''N''-heteroarylboronic acids. ''Green Chemistry'' '''2007''', ''9'', 1287–1291. {{doi|10.1039/B711965H}}

⚫
* C.A. Fleckenstein; H. Plenio, Efficient Suzuki-Miyaura Coupling of (Hetero)aryl Chlorides with Thiophene- and Furanboronic Acids in Aqueous n-Butanol. ''Journal of Organic Chemistry'' '''2008''', ''73'', 3236-3244.

* C.A Fleckenstein; R. Kadyrov; H. Plenio, Efficient Large-Scale Synthesis of 9-Alkylfluorenyl Phosphines for Pd-Catalyzed Cross-Coupling Reactions. ''Organic Process Research & Development'' '''2008''', ''12'', 475-479.

⚫
* C.A. Fleckenstein; H. Plenio, Aqueous cross-coupling. Highly efficient Suzuki-Miyaura coupling of N-heteroaryl halides and N-heteroarylboronic acids. ''Green Chemistry'' '''2007''', ''9'', 1287-1291.


== External links ==
== External links ==
* [http://www.sigmaaldrich.com/catalog/ProductDetail.do?lang=en&N4=688800|ALDRICH&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC ''Product information SigmaAldrich'']
* [http://www.sigmaaldrich.com/catalog/ProductDetail.do?lang=en&N4=688800|ALDRICH&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC Product information] from [[Sigma-Aldrich]]
* [http://www.strem.com/catalog/v/15-1078/52/''Product information Strem'']
* [http://www.strem.com/catalog/v/15-1078/52/Product information] from [[Strem Chemicals]]


{{DEFAULTSORT:Catacxium F Sulf}}
{{DEFAULTSORT:Catacxium F Sulf}}
[[Category:Organometallic chemistry]]
[[Category:Organometallic chemistry]]
[[Category:Quaternary phosphonium compounds]]
[[Category:Organophosphorus compounds]]
[[Category:Fluorenes]]

[[Category:Cyclohexyl compounds]]
[[de:CataCXium F sulf]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"